CAS 114672-02-5 appears in our catalog under these names: 1-Benzylcyclobutanecarboxylic acid, 98+%, 1-Benzylcyclobutanecarboxylic acid, 98+%, 98+%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 500mg.
1-benzylcyclobutane-1-carboxylic acid (CAS 114672-02-5) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 1-benzylcyclobutane-1-carboxylic acid. InChIKey: HMKZTNDNIPVLQW-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1-benzylcyclobutane-1-carboxylic acid |
| InChIKey | HMKZTNDNIPVLQW-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)