CAS 114694-29-0 is the registry number for (R)-2,3-Dimethyl1-(4-methylbenzenesulfonate)-1,3-butanediol. Offered by: TRC. Available pack sizes: 2,5g.
[(2R)-3-hydroxy-2,3-dimethylbutyl] 4-methylbenzenesulfonate (CAS 114694-29-0) is a chemical compound with the molecular formula C13H20O4S and a molecular weight of 272.36 g/mol. IUPAC name: [(2R)-3-hydroxy-2,3-dimethylbutyl] 4-methylbenzenesulfonate. InChIKey: PYQROWINYGUXKF-LLVKDONJSA-N.
| Molecular formula | C13H20O4S |
|---|---|
| Molecular weight | 272.36 g/mol |
| IUPAC name | [(2R)-3-hydroxy-2,3-dimethylbutyl] 4-methylbenzenesulfonate |
| InChIKey | PYQROWINYGUXKF-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](C)C(C)(C)O |
Computed by PubChem (NCBI)