CAS 74608-34-7 is the registry number for 2,3-Dimethyl-1-(4-methylbenzenesulfonate)-1,3-butanediol. Offered by: TRC. Available pack sizes: 1g.
(3-hydroxy-2,3-dimethylbutyl) 4-methylbenzenesulfonate (CAS 74608-34-7) is a chemical compound with the molecular formula C13H20O4S and a molecular weight of 272.36 g/mol. IUPAC name: (3-hydroxy-2,3-dimethylbutyl) 4-methylbenzenesulfonate. InChIKey: PYQROWINYGUXKF-UHFFFAOYSA-N.
| Molecular formula | C13H20O4S |
|---|---|
| Molecular weight | 272.36 g/mol |
| IUPAC name | (3-hydroxy-2,3-dimethylbutyl) 4-methylbenzenesulfonate |
| InChIKey | PYQROWINYGUXKF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)C(C)(C)O |
Computed by PubChem (NCBI)