Products 1146961-22-9
CAS 1146961-22-9 appears in our catalog under these names: 5-Dimethylamino-2-(2,2,2-trifluoro-acetyl)-penta-2,4-dienoic acid ethyl ester, 95%, (2E,4E)-5-Dimethylamino-2-(2,2,2-trifluoro-acetyl)-penta-2,4-dienoic acid ethyl ester, 95%, ethyl 5-(dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
Ethyl (2E,4E)-5-(dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate (CAS 1146961-22-9) is a chemical compound with the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. IUPAC name: ethyl (2E,4E)-5-(dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate. InChIKey: ALTVELAXYXCPIG-KQQUZDAGSA-N.
| Molecular formula | C11H14F3NO3 |
|---|---|
| Molecular weight | 265.23 g/mol |
| IUPAC name | ethyl (2E,4E)-5-(dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate |
| InChIKey | ALTVELAXYXCPIG-KQQUZDAGSA-N |
| SMILES | CCOC(=O)/C(=C/C=C/N(C)C)/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)