CAS 1213471-16-9 is the registry number for (S)-2,2,2-Trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine (CAS 1213471-16-9) is a chemical compound with the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine. InChIKey: DTMMWTIWVAGCLH-JTQLQIEISA-N.
| Molecular formula | C11H14F3NO3 |
|---|---|
| Molecular weight | 265.23 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine |
| InChIKey | DTMMWTIWVAGCLH-JTQLQIEISA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)