CAS 1147081-44-4 is the registry number for 2-(4-Bromophenyl)-1-(p-tolyl)-1H-phenanthro[9,10-d]imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-3-(4-methylphenyl)phenanthro[9,10-d]imidazole (CAS 1147081-44-4) is a chemical compound with the molecular formula C28H19BrN2 and a molecular weight of 463.4 g/mol. IUPAC name: 2-(4-bromophenyl)-3-(4-methylphenyl)phenanthro[9,10-d]imidazole. InChIKey: ZXNYPNDFNCSOFR-UHFFFAOYSA-N.
| Molecular formula | C28H19BrN2 |
|---|---|
| Molecular weight | 463.4 g/mol |
| IUPAC name | 2-(4-bromophenyl)-3-(4-methylphenyl)phenanthro[9,10-d]imidazole |
| InChIKey | ZXNYPNDFNCSOFR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C3=C(C4=CC=CC=C4C5=CC=CC=C53)N=C2C6=CC=C(C=C6)Br |
Computed by PubChem (NCBI)