CAS 1955546-93-6 is the registry number for 4-([1,1'-Biphenyl]-4-yl)-6-(3-bromophenyl)-2-phenylpyrimidine, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-bromophenyl)-2-phenyl-6-(4-phenylphenyl)pyrimidine (CAS 1955546-93-6) is a chemical compound with the molecular formula C28H19BrN2 and a molecular weight of 463.4 g/mol. IUPAC name: 4-(3-bromophenyl)-2-phenyl-6-(4-phenylphenyl)pyrimidine. InChIKey: MTKHYMXHSDGACA-UHFFFAOYSA-N.
| Molecular formula | C28H19BrN2 |
|---|---|
| Molecular weight | 463.4 g/mol |
| IUPAC name | 4-(3-bromophenyl)-2-phenyl-6-(4-phenylphenyl)pyrimidine |
| InChIKey | MTKHYMXHSDGACA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC(=NC(=N3)C4=CC=CC=C4)C5=CC(=CC=C5)Br |
Computed by PubChem (NCBI)