CAS 114715-76-3 is the registry number for Z-L-Ile-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
Benzyl N-[(3S,4S)-1-diazo-4-methyl-2-oxohexan-3-yl]carbamate (CAS 114715-76-3) is a chemical compound with the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. IUPAC name: benzyl N-[(3S,4S)-1-diazo-4-methyl-2-oxohexan-3-yl]carbamate. InChIKey: TVEZBIORYYZQAS-FZMZJTMJSA-N.
| Molecular formula | C15H19N3O3 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | benzyl N-[(3S,4S)-1-diazo-4-methyl-2-oxohexan-3-yl]carbamate |
| InChIKey | TVEZBIORYYZQAS-FZMZJTMJSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)C=[N+]=[N-])NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)