CAS 60398-41-6 is the registry number for Boc-L-Phe-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
Tert-butyl N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamate (CAS 60398-41-6) is a chemical compound with the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. IUPAC name: tert-butyl N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamate. InChIKey: RCMYIGTVOBGQJW-LBPRGKRZSA-N.
| Molecular formula | C15H19N3O3 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamate |
| InChIKey | RCMYIGTVOBGQJW-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)