Products 153232-73-6
CAS 153232-73-6 is the registry number for 4-Desisopropyl-4-propyl Imazethapyr. Offered by: TRC. Available pack sizes: 500mg.
5-ethyl-2-(4-methyl-5-oxo-4-propyl-1H-imidazol-2-yl)pyridine-3-carboxylic acid (CAS 153232-73-6) is a chemical compound with the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. IUPAC name: 5-ethyl-2-(4-methyl-5-oxo-4-propyl-1H-imidazol-2-yl)pyridine-3-carboxylic acid. InChIKey: JRORQDJBTMAFRO-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O3 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 5-ethyl-2-(4-methyl-5-oxo-4-propyl-1H-imidazol-2-yl)pyridine-3-carboxylic acid |
| InChIKey | JRORQDJBTMAFRO-UHFFFAOYSA-N |
| SMILES | CCCC1(C(=O)NC(=N1)C2=C(C=C(C=N2)CC)C(=O)O)C |
Computed by PubChem (NCBI)