Products 1147271-25-7

CAS 1147271-25-7 is the registry number for JNJ-40255293, 98.45%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 5 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

2-amino-8-(2-morpholin-4-ylethoxy)-4-phenylindeno[1,2-d]pyrimidin-5-one (CAS 1147271-25-7) is a chemical compound with the molecular formula C23H22N4O3 and a molecular weight of 402.4 g/mol. IUPAC name: 2-amino-8-(2-morpholin-4-ylethoxy)-4-phenylindeno[1,2-d]pyrimidin-5-one. InChIKey: BCDASHXLAMCATI-UHFFFAOYSA-N.

Identity
Molecular formulaC23H22N4O3
Molecular weight402.4 g/mol
IUPAC name2-amino-8-(2-morpholin-4-ylethoxy)-4-phenylindeno[1,2-d]pyrimidin-5-one
InChIKeyBCDASHXLAMCATI-UHFFFAOYSA-N
SMILESC1COCCN1CCOC2=CC3=C(C=C2)C(=O)C4=C(N=C(N=C34)N)C5=CC=CC=C5

Computed by PubChem (NCBI)