Products 869218-90-6

CAS 869218-90-6 is the registry number for AL-9, 99.68%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg, 100 mg, 50 mg.

Structural formula: {0} (CAS {1})

[5-[4-(4-morpholin-4-ylanilino)quinazolin-6-yl]furan-2-yl]methanol (CAS 869218-90-6) is a chemical compound with the molecular formula C23H22N4O3 and a molecular weight of 402.4 g/mol. IUPAC name: [5-[4-(4-morpholin-4-ylanilino)quinazolin-6-yl]furan-2-yl]methanol. InChIKey: LYZRWTKFOBBKKS-UHFFFAOYSA-N.

Identity
Molecular formulaC23H22N4O3
Molecular weight402.4 g/mol
IUPAC name[5-[4-(4-morpholin-4-ylanilino)quinazolin-6-yl]furan-2-yl]methanol
InChIKeyLYZRWTKFOBBKKS-UHFFFAOYSA-N
SMILESC1COCCN1C2=CC=C(C=C2)NC3=NC=NC4=C3C=C(C=C4)C5=CC=C(O5)CO

Computed by PubChem (NCBI)