CAS 1147299-45-3 is the registry number for L-Alanine Amide-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 5mg.
(2S)-2-amino-3,3,3-trideuteriopropanamide;hydrochloride (CAS 1147299-45-3) is a chemical compound with the molecular formula C3H9ClN2O and a molecular weight of 127.59 g/mol. IUPAC name: (2S)-2-amino-3,3,3-trideuteriopropanamide;hydrochloride. InChIKey: FIAINKIUSZGVGX-QQAVFRBQSA-N.
| Molecular formula | C3H9ClN2O |
|---|---|
| Molecular weight | 127.59 g/mol |
| IUPAC name | (2S)-2-amino-3,3,3-trideuteriopropanamide;hydrochloride |
| InChIKey | FIAINKIUSZGVGX-QQAVFRBQSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)