Products 1276197-35-3
CAS 1276197-35-3 appears in our catalog under these names: 3-Aminopropionamide-2,2,3,3-d4 Hydrochloride, 3-Aminopropionamide-2,2,3,3-d4 HCl, 3-Aminopropionamide-2,2,3,3-d4 HCl, 98 atom % D, min 98% Chemical Purity, H–β–Ala–NH2·–d4 HCl, H-β-Ala-NH2.-d4HCl, 98.60%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,01g, 0,005g, 1 mg.
3-amino-2,2,3,3-tetradeuteriopropanamide;hydrochloride (CAS 1276197-35-3) is a chemical compound with the molecular formula C3H9ClN2O and a molecular weight of 128.59 g/mol. IUPAC name: 3-amino-2,2,3,3-tetradeuteriopropanamide;hydrochloride. InChIKey: GAGJMOQGABUOBK-PBCJVBLFSA-N.
| Molecular formula | C3H9ClN2O |
|---|---|
| Molecular weight | 128.59 g/mol |
| IUPAC name | 3-amino-2,2,3,3-tetradeuteriopropanamide;hydrochloride |
| InChIKey | GAGJMOQGABUOBK-PBCJVBLFSA-N |
| SMILES | [2H]C([2H])(C(=O)N)C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)