Products 114773-20-5
CAS 114773-20-5 is the registry number for NIC. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-butyl-5-chloro-3-[(4-nitrophenyl)methyl]imidazole-4-carbaldehyde (CAS 114773-20-5) is a chemical compound with the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. IUPAC name: 2-butyl-5-chloro-3-[(4-nitrophenyl)methyl]imidazole-4-carbaldehyde. InChIKey: MXOCRZVWJNLURA-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3O3 |
|---|---|
| Molecular weight | 321.76 g/mol |
| IUPAC name | 2-butyl-5-chloro-3-[(4-nitrophenyl)methyl]imidazole-4-carbaldehyde |
| InChIKey | MXOCRZVWJNLURA-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC(=C(N1CC2=CC=C(C=C2)[N+](=O)[O-])C=O)Cl |
Computed by PubChem (NCBI)