CAS 2504201-32-3 is the registry number for Dl-phenylalanine 4-nitroanilide hydrochloride salt, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride (CAS 2504201-32-3) is a chemical compound with the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. IUPAC name: 2-amino-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride. InChIKey: PUPPBYXRHSFLCY-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3O3 |
|---|---|
| Molecular weight | 321.76 g/mol |
| IUPAC name | 2-amino-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride |
| InChIKey | PUPPBYXRHSFLCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)