Products 2504201-32-3

CAS 2504201-32-3 is the registry number for Dl-phenylalanine 4-nitroanilide hydrochloride salt, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride (CAS 2504201-32-3) is a chemical compound with the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. IUPAC name: 2-amino-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride. InChIKey: PUPPBYXRHSFLCY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16ClN3O3
Molecular weight321.76 g/mol
IUPAC name2-amino-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride
InChIKeyPUPPBYXRHSFLCY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N.Cl

Computed by PubChem (NCBI)