CAS 1148003-52-4 is the registry number for 2-[(2R,6S)-2,6-Dimethylpiperazin-1-yl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(2R,6S)-2,6-dimethylpiperazin-1-yl]acetamide (CAS 1148003-52-4) is a chemical compound with the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. IUPAC name: 2-[(2R,6S)-2,6-dimethylpiperazin-1-yl]acetamide. InChIKey: XCXHUKQRFJSDGZ-KNVOCYPGSA-N.
| Molecular formula | C8H17N3O |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 2-[(2R,6S)-2,6-dimethylpiperazin-1-yl]acetamide |
| InChIKey | XCXHUKQRFJSDGZ-KNVOCYPGSA-N |
| SMILES | C[C@@H]1CNC[C@@H](N1CC(=O)N)C |
Computed by PubChem (NCBI)