Products 1269225-06-0

CAS 1269225-06-0 is the registry number for 3,4-Diethyl-1-methyl-1h-pyrazol-5-amine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

4,5-diethyl-2-methylpyrazol-3-amine;hydrate (CAS 1269225-06-0) is a chemical compound with the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. IUPAC name: 4,5-diethyl-2-methylpyrazol-3-amine;hydrate. InChIKey: OZYHDGQTHKWQGD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17N3O
Molecular weight171.24 g/mol
IUPAC name4,5-diethyl-2-methylpyrazol-3-amine;hydrate
InChIKeyOZYHDGQTHKWQGD-UHFFFAOYSA-N
SMILESCCC1=C(N(N=C1CC)C)N.O

Computed by PubChem (NCBI)