CAS 114810-56-9 is the registry number for 2-Iodo-4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentan-1-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
4,5,5,5-tetrafluoro-2-iodo-4-(trifluoromethyl)pentan-1-ol (CAS 114810-56-9) is a chemical compound with the molecular formula C6H6F7IO and a molecular weight of 354.00 g/mol. IUPAC name: 4,5,5,5-tetrafluoro-2-iodo-4-(trifluoromethyl)pentan-1-ol. InChIKey: VCOYOPKEJYAJCN-UHFFFAOYSA-N.
| Molecular formula | C6H6F7IO |
|---|---|
| Molecular weight | 354.00 g/mol |
| IUPAC name | 4,5,5,5-tetrafluoro-2-iodo-4-(trifluoromethyl)pentan-1-ol |
| InChIKey | VCOYOPKEJYAJCN-UHFFFAOYSA-N |
| SMILES | C(C(CO)I)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)