CAS 647-84-7 is the registry number for 4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol (CAS 647-84-7) is a chemical compound with the molecular formula C6H6F7IO and a molecular weight of 354.00 g/mol. IUPAC name: 4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol. InChIKey: ITASBCIXGRCUAD-UHFFFAOYSA-N.
| Molecular formula | C6H6F7IO |
|---|---|
| Molecular weight | 354.00 g/mol |
| IUPAC name | 4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol |
| InChIKey | ITASBCIXGRCUAD-UHFFFAOYSA-N |
| SMILES | C(C(CO)I)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)