CAS 114949-13-2 is the registry number for 3,4-Dihydro-1-naphthaleneacetyl Chloride. Offered by: TRC. Available pack sizes: 250mg.
2-(3,4-dihydronaphthalen-1-yl)acetyl chloride (CAS 114949-13-2) is a chemical compound with the molecular formula C12H11ClO and a molecular weight of 206.67 g/mol. IUPAC name: 2-(3,4-dihydronaphthalen-1-yl)acetyl chloride. InChIKey: IOESOTJLHGNTNA-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 2-(3,4-dihydronaphthalen-1-yl)acetyl chloride |
| InChIKey | IOESOTJLHGNTNA-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(=C1)CC(=O)Cl |
Computed by PubChem (NCBI)