CAS 854726-05-9 appears in our catalog under these names: 2'-Chloro-5,6-dihydro-[1,1'-biphenyl]-3(4H)-one, 98%, 3-(2-Chlorophenyl)-2-cyclohexen-1-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
3-(2-chlorophenyl)cyclohex-2-en-1-one (CAS 854726-05-9) is a chemical compound with the molecular formula C12H11ClO and a molecular weight of 206.67 g/mol. IUPAC name: 3-(2-chlorophenyl)cyclohex-2-en-1-one. InChIKey: JMLHJCDLKMQHHX-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 3-(2-chlorophenyl)cyclohex-2-en-1-one |
| InChIKey | JMLHJCDLKMQHHX-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)