CAS 114991-16-1 is the registry number for N’-Desmethyl Amonafide. Offered by: TRC. Available pack sizes: 25mg.
5-amino-2-[2-(methylamino)ethyl]benzo[de]isoquinoline-1,3-dione (CAS 114991-16-1) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: 5-amino-2-[2-(methylamino)ethyl]benzo[de]isoquinoline-1,3-dione. InChIKey: JFLYCGLQHZUVQZ-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 5-amino-2-[2-(methylamino)ethyl]benzo[de]isoquinoline-1,3-dione |
| InChIKey | JFLYCGLQHZUVQZ-UHFFFAOYSA-N |
| SMILES | CNCCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)N |
Computed by PubChem (NCBI)