CAS 1150114-65-0 appears in our catalog under these names: 4,6-Dichloro-1,3-phenylenediboronic acid, 98%, (4,6-Dichloro-1,3-phenylene)diboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(5-borono-2,4-dichlorophenyl)boronic acid (CAS 1150114-65-0) is a chemical compound with the molecular formula C6H6B2Cl2O4 and a molecular weight of 234.6 g/mol. IUPAC name: (5-borono-2,4-dichlorophenyl)boronic acid. InChIKey: YCEOXNHPRQXRBD-UHFFFAOYSA-N.
| Molecular formula | C6H6B2Cl2O4 |
|---|---|
| Molecular weight | 234.6 g/mol |
| IUPAC name | (5-borono-2,4-dichlorophenyl)boronic acid |
| InChIKey | YCEOXNHPRQXRBD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)B(O)O)(O)O |
Computed by PubChem (NCBI)