CAS 2930101-42-9 is the registry number for (2,5-Dichloro-1,4-phenylene)diboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4-borono-2,5-dichlorophenyl)boronic acid (CAS 2930101-42-9) is a chemical compound with the molecular formula C6H6B2Cl2O4 and a molecular weight of 234.6 g/mol. IUPAC name: (4-borono-2,5-dichlorophenyl)boronic acid. InChIKey: CZQZOFDRYOKWIM-UHFFFAOYSA-N.
| Molecular formula | C6H6B2Cl2O4 |
|---|---|
| Molecular weight | 234.6 g/mol |
| IUPAC name | (4-borono-2,5-dichlorophenyl)boronic acid |
| InChIKey | CZQZOFDRYOKWIM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)B(O)O)Cl)(O)O |
Computed by PubChem (NCBI)