Products 1150114-68-3

CAS 1150114-68-3 is the registry number for 5-Chloro-6-ethoxypyridine-3-boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

(5-chloro-6-ethoxy-3-pyridinyl)boronic acid (CAS 1150114-68-3) is a chemical compound with the molecular formula C7H9BClNO3 and a molecular weight of 201.42 g/mol. IUPAC name: (5-chloro-6-ethoxy-3-pyridinyl)boronic acid. InChIKey: PRZRXDHALIHUBT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9BClNO3
Molecular weight201.42 g/mol
IUPAC name(5-chloro-6-ethoxy-3-pyridinyl)boronic acid
InChIKeyPRZRXDHALIHUBT-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1)OCC)Cl)(O)O

Computed by PubChem (NCBI)