CAS 1882041-03-3 is the registry number for 5-Chloro-2-ethoxypyridine-4-boronic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(5-chloro-2-ethoxy-4-pyridinyl)boronic acid (CAS 1882041-03-3) is a chemical compound with the molecular formula C7H9BClNO3 and a molecular weight of 201.42 g/mol. IUPAC name: (5-chloro-2-ethoxy-4-pyridinyl)boronic acid. InChIKey: DMUMNNOZBLLGMV-UHFFFAOYSA-N.
| Molecular formula | C7H9BClNO3 |
|---|---|
| Molecular weight | 201.42 g/mol |
| IUPAC name | (5-chloro-2-ethoxy-4-pyridinyl)boronic acid |
| InChIKey | DMUMNNOZBLLGMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1Cl)OCC)(O)O |
Computed by PubChem (NCBI)