Products 1882041-03-3

CAS 1882041-03-3 is the registry number for 5-Chloro-2-ethoxypyridine-4-boronic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(5-chloro-2-ethoxy-4-pyridinyl)boronic acid (CAS 1882041-03-3) is a chemical compound with the molecular formula C7H9BClNO3 and a molecular weight of 201.42 g/mol. IUPAC name: (5-chloro-2-ethoxy-4-pyridinyl)boronic acid. InChIKey: DMUMNNOZBLLGMV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9BClNO3
Molecular weight201.42 g/mol
IUPAC name(5-chloro-2-ethoxy-4-pyridinyl)boronic acid
InChIKeyDMUMNNOZBLLGMV-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1Cl)OCC)(O)O

Computed by PubChem (NCBI)