CAS 1150164-28-5 is the registry number for Methyl 1-(5-bromopyridin-2-yl)-5-tert-butylpyrazole-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 1-(5-bromo-2-pyridinyl)-5-tert-butylpyrazole-4-carboxylate (CAS 1150164-28-5) is a chemical compound with the molecular formula C14H16BrN3O2 and a molecular weight of 338.20 g/mol. IUPAC name: methyl 1-(5-bromo-2-pyridinyl)-5-tert-butylpyrazole-4-carboxylate. InChIKey: SIWZTEGEKNCSPV-UHFFFAOYSA-N.
| Molecular formula | C14H16BrN3O2 |
|---|---|
| Molecular weight | 338.20 g/mol |
| IUPAC name | methyl 1-(5-bromo-2-pyridinyl)-5-tert-butylpyrazole-4-carboxylate |
| InChIKey | SIWZTEGEKNCSPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=NN1C2=NC=C(C=C2)Br)C(=O)OC |
Computed by PubChem (NCBI)