CAS 3313-48-2 appears in our catalog under these names: H–Gly–Gly–βNA · HBr, H-Gly-Gly-bNA·HBr. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 1000mg, 2000mg, 5000mg.
2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]acetamide;hydrobromide (CAS 3313-48-2) is a chemical compound with the molecular formula C14H16BrN3O2 and a molecular weight of 338.20 g/mol. IUPAC name: 2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]acetamide;hydrobromide. InChIKey: HBILDMMVUMVIMF-UHFFFAOYSA-N.
| Molecular formula | C14H16BrN3O2 |
|---|---|
| Molecular weight | 338.20 g/mol |
| IUPAC name | 2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]acetamide;hydrobromide |
| InChIKey | HBILDMMVUMVIMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)CNC(=O)CN.Br |
Computed by PubChem (NCBI)