Products 115017-61-3
CAS 115017-61-3 appears in our catalog under these names: R-(-)-Norapomorphine Hydrobromide, >95% (HPLC), R(–)–Norapomorphine hydrobromide. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 1mg, 5mg.
(6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrobromide (CAS 115017-61-3) is a chemical compound with the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. IUPAC name: (6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrobromide. InChIKey: SKTWZBLODKWJOU-UTONKHPSSA-N.
| Molecular formula | C16H16BrNO2 |
|---|---|
| Molecular weight | 334.21 g/mol |
| IUPAC name | (6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrobromide |
| InChIKey | SKTWZBLODKWJOU-UTONKHPSSA-N |
| SMILES | C1CN[C@@H]2CC3=C(C4=CC=CC1=C24)C(=C(C=C3)O)O.Br |
Computed by PubChem (NCBI)