Products 1482764-26-0
CAS 1482764-26-0 is the registry number for 2-(3-Bromophenyl)-1-(2,3-dihydro-1,4-benzodioxin-2-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-bromophenyl)-1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethanamine (CAS 1482764-26-0) is a chemical compound with the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. IUPAC name: 2-(3-bromophenyl)-1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethanamine. InChIKey: DMKHAUAGJVHUKP-UHFFFAOYSA-N.
| Molecular formula | C16H16BrNO2 |
|---|---|
| Molecular weight | 334.21 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethanamine |
| InChIKey | DMKHAUAGJVHUKP-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(CC3=CC(=CC=C3)Br)N |
Computed by PubChem (NCBI)