CAS 1150263-83-4 is the registry number for (1S)-1-(1H-1,2,4-Triazol-3-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S)-1-(1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride (CAS 1150263-83-4) is a chemical compound with the molecular formula C4H10Cl2N4 and a molecular weight of 185.05 g/mol. IUPAC name: (1S)-1-(1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride. InChIKey: MXQKUBMTWVPBFS-QTNFYWBSSA-N.
| Molecular formula | C4H10Cl2N4 |
|---|---|
| Molecular weight | 185.05 g/mol |
| IUPAC name | (1S)-1-(1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride |
| InChIKey | MXQKUBMTWVPBFS-QTNFYWBSSA-N |
| SMILES | C[C@@H](C1=NC=NN1)N.Cl.Cl |
Computed by PubChem (NCBI)