Products 199340-92-6

CAS 199340-92-6 is the registry number for 3-Methyl-1h-pyrazole-4,5-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-methyl-1H-pyrazole-3,4-diamine;dihydrochloride (CAS 199340-92-6) is a chemical compound with the molecular formula C4H10Cl2N4 and a molecular weight of 185.05 g/mol. IUPAC name: 5-methyl-1H-pyrazole-3,4-diamine;dihydrochloride. InChIKey: QRLLARVXPUOAOU-UHFFFAOYSA-N.

Identity
Molecular formulaC4H10Cl2N4
Molecular weight185.05 g/mol
IUPAC name5-methyl-1H-pyrazole-3,4-diamine;dihydrochloride
InChIKeyQRLLARVXPUOAOU-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1)N)N.Cl.Cl

Computed by PubChem (NCBI)