CAS 1150271-20-7 is the registry number for 2-(4-Bromo-3,5-dimethylpyrazol-1-yl)-6-chloropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-6-chloropyridine (CAS 1150271-20-7) is a chemical compound with the molecular formula C10H9BrClN3 and a molecular weight of 286.55 g/mol. IUPAC name: 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-6-chloropyridine. InChIKey: MOYUQSUBLGTDKL-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClN3 |
|---|---|
| Molecular weight | 286.55 g/mol |
| IUPAC name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-6-chloropyridine |
| InChIKey | MOYUQSUBLGTDKL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=NC(=CC=C2)Cl)C)Br |
Computed by PubChem (NCBI)