CAS 925147-38-2 is the registry number for 4-Bromo-1-((2-chlorophenyl)methyl)-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-amine (CAS 925147-38-2) is a chemical compound with the molecular formula C10H9BrClN3 and a molecular weight of 286.55 g/mol. IUPAC name: 4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-amine. InChIKey: SLCHRHUMZBOKOR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClN3 |
|---|---|
| Molecular weight | 286.55 g/mol |
| IUPAC name | 4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-amine |
| InChIKey | SLCHRHUMZBOKOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(C(=N2)N)Br)Cl |
Computed by PubChem (NCBI)