CAS 1150561-55-9 is the registry number for 5-Cyano-2-fluoro-3-methoxyphenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1150561-55-9) is a chemical compound with the molecular formula C14H17BFNO3 and a molecular weight of 277.10 g/mol. IUPAC name: 4-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: MDLUJXDPEWBRKS-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO3 |
|---|---|
| Molecular weight | 277.10 g/mol |
| IUPAC name | 4-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | MDLUJXDPEWBRKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)OC)C#N |
Computed by PubChem (NCBI)