CAS 1383985-45-2 is the registry number for 3-Cyano-4-fluoro-5-methoxyphenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1383985-45-2) is a chemical compound with the molecular formula C14H17BFNO3 and a molecular weight of 277.10 g/mol. IUPAC name: 2-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: YQNWWJOWFUFQMD-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO3 |
|---|---|
| Molecular weight | 277.10 g/mol |
| IUPAC name | 2-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | YQNWWJOWFUFQMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)OC)F)C#N |
Computed by PubChem (NCBI)