CAS 115057-37-9 appears in our catalog under these names: (9H-Fluoren-9-yl)methyl (2-amino-2-oxoethyl)carbamate, 97%, Fmoc-Gly-NH2 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
9H-fluoren-9-ylmethyl N-(2-amino-2-oxoethyl)carbamate (CAS 115057-37-9) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-amino-2-oxoethyl)carbamate. InChIKey: XGWGOMVAVWRQOC-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-amino-2-oxoethyl)carbamate |
| InChIKey | XGWGOMVAVWRQOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)N |
Computed by PubChem (NCBI)