CAS 1151801-90-9 appears in our catalog under these names: 2,3-Difluoro-5-(1-methyl-1H-pyrazol-4-yl)pyridine, 97%, 2，3–Difluoro–5–(1–methyl–1H–pyrazol–4–yl)pyridine. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
2,3-difluoro-5-(1-methylpyrazol-4-yl)pyridine (CAS 1151801-90-9) is a chemical compound with the molecular formula C9H7F2N3 and a molecular weight of 195.17 g/mol. IUPAC name: 2,3-difluoro-5-(1-methylpyrazol-4-yl)pyridine. InChIKey: GFHXYORKLHVVET-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2,3-difluoro-5-(1-methylpyrazol-4-yl)pyridine |
| InChIKey | GFHXYORKLHVVET-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC(=C(N=C2)F)F |
Computed by PubChem (NCBI)