Products 1245007-16-2
CAS 1245007-16-2 appears in our catalog under these names: 1-(2,6-Difluorophenyl)-1H-pyrazol-4-amine, 97%, 1-(2,6-Difluorophenyl)-1H-pyrazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
1-(2,6-difluorophenyl)pyrazol-4-amine (CAS 1245007-16-2) is a chemical compound with the molecular formula C9H7F2N3 and a molecular weight of 195.17 g/mol. IUPAC name: 1-(2,6-difluorophenyl)pyrazol-4-amine. InChIKey: JKVMDTYXFGYYHD-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)pyrazol-4-amine |
| InChIKey | JKVMDTYXFGYYHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N2C=C(C=N2)N)F |
Computed by PubChem (NCBI)