CAS 1151805-39-8 appears in our catalog under these names: Cyclopentyl (2S)-2-amino-3-phenylpropanoate hydrochloride, 95%, Cyclopentyl (2S)-2-amino-3-phenylpropanoate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Cyclopentyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CAS 1151805-39-8) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: cyclopentyl (2S)-2-amino-3-phenylpropanoate;hydrochloride. InChIKey: QWSZAZFVAIBABP-ZOWNYOTGSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | cyclopentyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | QWSZAZFVAIBABP-ZOWNYOTGSA-N |
| SMILES | C1CCC(C1)OC(=O)[C@H](CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)