CAS 115186-33-9 appears in our catalog under these names: N-((1R)-2-(Methoxymethylamino)-2-oxo-1-(phenylmethyl)ethyl)carbamic Acid 1,1-Dimethylethyl Ester, (R)-tert-Butyl (1-(methoxy(methyl)amino)-1-oxo-3-phenylpropan-2-yl)carbamate, 97+%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 250mg, 1g, 25g.
Tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 115186-33-9) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: ZAHRDPIWMGLOQJ-CYBMUJFWSA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 308.37 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | ZAHRDPIWMGLOQJ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)