CAS 115237-06-4 is the registry number for (((2-Bromo-1,3-phenylene)bis(oxy))bis(methylene))dibenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1,3-bis(phenylmethoxy)benzene (CAS 115237-06-4) is a chemical compound with the molecular formula C20H17BrO2 and a molecular weight of 369.3 g/mol. IUPAC name: 2-bromo-1,3-bis(phenylmethoxy)benzene. InChIKey: CQHJPLIJQIKRBS-UHFFFAOYSA-N.
| Molecular formula | C20H17BrO2 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | 2-bromo-1,3-bis(phenylmethoxy)benzene |
| InChIKey | CQHJPLIJQIKRBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC=C2)OCC3=CC=CC=C3)Br |
Computed by PubChem (NCBI)