CAS 634922-10-4 appears in our catalog under these names: Pro-gly-ome tfa, 95%, Pro–Gly–OMe TFA, Pro-Gly-OMe TFA, ≥95%, ≥95%, Methyl (S)-prolylglycinate 2,2,2-trifluoroacetate, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
4-bromo-1,2-bis(phenylmethoxy)benzene (CAS 634922-10-4) is a chemical compound with the molecular formula C20H17BrO2 and a molecular weight of 369.3 g/mol. IUPAC name: 4-bromo-1,2-bis(phenylmethoxy)benzene. InChIKey: LBAPEDPREBPULC-UHFFFAOYSA-N.
| Molecular formula | C20H17BrO2 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | 4-bromo-1,2-bis(phenylmethoxy)benzene |
| InChIKey | LBAPEDPREBPULC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)