CAS 1152427-91-2 appears in our catalog under these names: 6-Methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione, 95+%, 6-Methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1152427-91-2) is a chemical compound with the molecular formula C7H10BNO5 and a molecular weight of 198.97 g/mol. IUPAC name: 6-methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: USSYHTHDUBKRQF-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO5 |
|---|---|
| Molecular weight | 198.97 g/mol |
| IUPAC name | 6-methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | USSYHTHDUBKRQF-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2CO2 |
Computed by PubChem (NCBI)