CAS 2098853-32-6 is the registry number for Tetrahydro-6-methyl-4,8-dioxo-4H-1,3,6,2-dioxazaborocine-2-acetaldehyde. Offered by: TRC. Available pack sizes: 100mg.
2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)acetaldehyde (CAS 2098853-32-6) is a chemical compound with the molecular formula C7H10BNO5 and a molecular weight of 198.97 g/mol. IUPAC name: 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)acetaldehyde. InChIKey: SSXHAJNEYLJGEM-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO5 |
|---|---|
| Molecular weight | 198.97 g/mol |
| IUPAC name | 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)acetaldehyde |
| InChIKey | SSXHAJNEYLJGEM-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)CC=O |
Computed by PubChem (NCBI)