Products 1152440-23-7
CAS 1152440-23-7 appears in our catalog under these names: Loxoprofen Impurity 16, Loxoprofen Impurity 40, Loxoprofen Ethoxy Carbonyl Methyl Ester, Methyl 4-((1-(ethoxycarbonyl)-2-oxocyclopentyl)methyl)-α-methylbenzeneacetate. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
Ethyl 1-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methyl]-2-oxocyclopentane-1-carboxylate (CAS 1152440-23-7) is a chemical compound with the molecular formula C19H24O5 and a molecular weight of 332.4 g/mol. IUPAC name: ethyl 1-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methyl]-2-oxocyclopentane-1-carboxylate. InChIKey: HJPYJGPAWARAIF-UHFFFAOYSA-N.
| Molecular formula | C19H24O5 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | ethyl 1-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methyl]-2-oxocyclopentane-1-carboxylate |
| InChIKey | HJPYJGPAWARAIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCCC1=O)CC2=CC=C(C=C2)C(C)C(=O)OC |
Computed by PubChem (NCBI)