Products 438030-13-8

CAS 438030-13-8 is the registry number for [(3-Hexyl-4,8-dimethyl-2-oxo-2h-chromen-7-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetic acid (CAS 438030-13-8) is a chemical compound with the molecular formula C19H24O5 and a molecular weight of 332.4 g/mol. IUPAC name: 2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetic acid. InChIKey: XVWAHGIUZVRYQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H24O5
Molecular weight332.4 g/mol
IUPAC name2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetic acid
InChIKeyXVWAHGIUZVRYQQ-UHFFFAOYSA-N
SMILESCCCCCCC1=C(C2=C(C(=C(C=C2)OCC(=O)O)C)OC1=O)C

Computed by PubChem (NCBI)