CAS 1152502-18-5 is the registry number for 4-Methyl-1-[(1-methyl-1h-pyrazol-4-yl)methyl]-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-methyl-1-[(1-methylpyrazol-4-yl)methyl]pyrazol-5-amine (CAS 1152502-18-5) is a chemical compound with the molecular formula C9H13N5 and a molecular weight of 191.23 g/mol. IUPAC name: 4-methyl-1-[(1-methylpyrazol-4-yl)methyl]pyrazol-5-amine. InChIKey: YKWFKVBDKQHKOO-UHFFFAOYSA-N.
| Molecular formula | C9H13N5 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 4-methyl-1-[(1-methylpyrazol-4-yl)methyl]pyrazol-5-amine |
| InChIKey | YKWFKVBDKQHKOO-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)CC2=CN(N=C2)C)N |
Computed by PubChem (NCBI)