CAS 15233-33-7 appears in our catalog under these names: N-(Diaminomethylene)-n'-(4-methylphenyl)guanidine hydrochloride, 95%, 1-Carbamimidamido-N-(4-methylphenyl)methanimidamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
1-(diaminomethylidene)-2-(4-methylphenyl)guanidine (CAS 15233-33-7) is a chemical compound with the molecular formula C9H13N5 and a molecular weight of 191.23 g/mol. IUPAC name: 1-(diaminomethylidene)-2-(4-methylphenyl)guanidine. InChIKey: ILEIGUXOYKZHRK-UHFFFAOYSA-N.
| Molecular formula | C9H13N5 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 1-(diaminomethylidene)-2-(4-methylphenyl)guanidine |
| InChIKey | ILEIGUXOYKZHRK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=C(N)N=C(N)N |
Computed by PubChem (NCBI)